C19H20N4O8S — CID 16796569
[1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-[(3-nitrophenyl)sulfonylamino]benzoate (PubChem CID 16796569) has the molecular formula C19H20N4O8S and a molecular weight of 464.46 g/mol. Its IUPAC name is [1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-[(3-nitrophenyl)sulfonylamino]benzoate.
| Compound Name | [1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-[(3-nitrophenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 16796569 |
| Molecular Formula | C19H20N4O8S |
| Molecular Weight | 464.46 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | [1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-[(3-nitrophenyl)sulfonylamino]benzoate |
| SMILES | CC(C)C(OC(=O)c1ccccc1NS(=O)(=O)c1cccc([N+](=O)[O-])c1)C(=O)NC(N)=O |
| InChI | InChI=1S/C19H20N4O8S/c1-11(2)16(17(24)21-19(20)26)31-18(25)14-8-3-4-9-15(14)22-32(29,30)13-7-5-6-12(10-13)23(27)28/h3-11,16,22H,1-2H3,(H3,20,21,24,26) |
| InChIKey | RWSMCIMIJKGKEB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 187.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.46 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|