C20H22N4O8S — CID 40938318
[(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-[(2-methyl-5-nitrophenyl)sulfonylamino]benzoate (PubChem CID 40938318) has the molecular formula C20H22N4O8S and a molecular weight of 478.48 g/mol. Its IUPAC name is [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-[(2-methyl-5-nitrophenyl)sulfonylamino]benzoate.
| Compound Name | [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-[(2-methyl-5-nitrophenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 40938318 |
| Molecular Formula | C20H22N4O8S |
| Molecular Weight | 478.48 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-[(2-methyl-5-nitrophenyl)sulfonylamino]benzoate |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)Nc1ccccc1C(=O)O[C@H](C(=O)NC(N)=O)C(C)C |
| InChI | InChI=1S/C20H22N4O8S/c1-11(2)17(18(25)22-20(21)27)32-19(26)14-6-4-5-7-15(14)23-33(30,31)16-10-13(24(28)29)9-8-12(16)3/h4-11,17,23H,1-3H3,(H3,21,22,25,27)/t17-/m0/s1 |
| InChIKey | BLPXKMLASWMLER-KRWDZBQOSA-N |
| XLogP | 2.08 |
| TPSA | 187.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.48 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|