C13H15ClN2O4 — CID 7866412
[(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-chlorobenzoate (PubChem CID 7866412) has the molecular formula C13H15ClN2O4 and a molecular weight of 298.73 g/mol. Its IUPAC name is [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-chlorobenzoate.
| Compound Name | [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 7866412 |
| Molecular Formula | C13H15ClN2O4 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-chlorobenzoate |
| SMILES | CC(C)[C@H](OC(=O)c1ccccc1Cl)C(=O)NC(N)=O |
| InChI | InChI=1S/C13H15ClN2O4/c1-7(2)10(11(17)16-13(15)19)20-12(18)8-5-3-4-6-9(8)14/h3-7,10H,1-2H3,(H3,15,16,17,19)/t10-/m0/s1 |
| InChIKey | MQPKEXKPYNXGSH-JTQLQIEISA-N |
| XLogP | 1.72 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |