C13H13Cl2FN2O4 — CID 8651413
[(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2,4-dichloro-5-fluorobenzoate (PubChem CID 8651413) has the molecular formula C13H13Cl2FN2O4 and a molecular weight of 351.16 g/mol. Its IUPAC name is [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2,4-dichloro-5-fluorobenzoate.
| Compound Name | [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2,4-dichloro-5-fluorobenzoate |
|---|---|
| PubChem CID | 8651413 |
| Molecular Formula | C13H13Cl2FN2O4 |
| Molecular Weight | 351.16 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2,4-dichloro-5-fluorobenzoate |
| SMILES | CC(C)[C@H](OC(=O)c1cc(F)c(Cl)cc1Cl)C(=O)NC(N)=O |
| InChI | InChI=1S/C13H13Cl2FN2O4/c1-5(2)10(11(19)18-13(17)21)22-12(20)6-3-9(16)8(15)4-7(6)14/h3-5,10H,1-2H3,(H3,17,18,19,21)/t10-/m0/s1 |
| InChIKey | QELGZUJHCUWCDL-JTQLQIEISA-N |
| XLogP | 2.51 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.16 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|