C11H10ClFN2O4 — CID 16529443
[1-(carbamoylamino)-1-oxopropan-2-yl] 2-chloro-4-fluorobenzoate (PubChem CID 16529443) has the molecular formula C11H10ClFN2O4 and a molecular weight of 288.66 g/mol. Its IUPAC name is [1-(carbamoylamino)-1-oxopropan-2-yl] 2-chloro-4-fluorobenzoate.
| Compound Name | [1-(carbamoylamino)-1-oxopropan-2-yl] 2-chloro-4-fluorobenzoate |
|---|---|
| PubChem CID | 16529443 |
| Molecular Formula | C11H10ClFN2O4 |
| Molecular Weight | 288.66 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | [1-(carbamoylamino)-1-oxopropan-2-yl] 2-chloro-4-fluorobenzoate |
| SMILES | CC(OC(=O)c1ccc(F)cc1Cl)C(=O)NC(N)=O |
| InChI | InChI=1S/C11H10ClFN2O4/c1-5(9(16)15-11(14)18)19-10(17)7-3-2-6(13)4-8(7)12/h2-5H,1H3,(H3,14,15,16,18) |
| InChIKey | MROHIPWIMSDTLW-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.66 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |