C10H9ClFNO3 — CID 2570251
[(2R)-1-amino-1-oxopropan-2-yl] 2-chloro-4-fluorobenzoate (PubChem CID 2570251) has the molecular formula C10H9ClFNO3 and a molecular weight of 245.64 g/mol. Its IUPAC name is [(2R)-1-amino-1-oxopropan-2-yl] 2-chloro-4-fluorobenzoate.
| Compound Name | [(2R)-1-amino-1-oxopropan-2-yl] 2-chloro-4-fluorobenzoate |
|---|---|
| PubChem CID | 2570251 |
| Molecular Formula | C10H9ClFNO3 |
| Molecular Weight | 245.64 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | [(2R)-1-amino-1-oxopropan-2-yl] 2-chloro-4-fluorobenzoate |
| SMILES | C[C@@H](OC(=O)c1ccc(F)cc1Cl)C(N)=O |
| InChI | InChI=1S/C10H9ClFNO3/c1-5(9(13)14)16-10(15)7-3-2-6(12)4-8(7)11/h2-5H,1H3,(H2,13,14)/t5-/m1/s1 |
| InChIKey | AVWPYDOHATXCGZ-RXMQYKEDSA-N |
| XLogP | 1.51 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.64 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |