C11H12ClNO3S — CID 2103450
[(2S)-1-amino-1-oxopropan-2-yl] 2-chloro-5-methylsulfanylbenzoate (PubChem CID 2103450) has the molecular formula C11H12ClNO3S and a molecular weight of 273.74 g/mol. Its IUPAC name is [(2S)-1-amino-1-oxopropan-2-yl] 2-chloro-5-methylsulfanylbenzoate.
| Compound Name | [(2S)-1-amino-1-oxopropan-2-yl] 2-chloro-5-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 2103450 |
| Molecular Formula | C11H12ClNO3S |
| Molecular Weight | 273.74 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | [(2S)-1-amino-1-oxopropan-2-yl] 2-chloro-5-methylsulfanylbenzoate |
| SMILES | CSc1ccc(Cl)c(C(=O)O[C@@H](C)C(N)=O)c1 |
| InChI | InChI=1S/C11H12ClNO3S/c1-6(10(13)14)16-11(15)8-5-7(17-2)3-4-9(8)12/h3-6H,1-2H3,(H2,13,14)/t6-/m0/s1 |
| InChIKey | HVKWFBFURPLQQN-LURJTMIESA-N |
| XLogP | 2.09 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.74 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |