C10H9Cl2NO3 — CID 7508328
[(2S)-1-amino-1-oxopropan-2-yl] 2,4-dichlorobenzoate (PubChem CID 7508328) has the molecular formula C10H9Cl2NO3 and a molecular weight of 262.09 g/mol. Its IUPAC name is [(2S)-1-amino-1-oxopropan-2-yl] 2,4-dichlorobenzoate.
| Compound Name | [(2S)-1-amino-1-oxopropan-2-yl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 7508328 |
| Molecular Formula | C10H9Cl2NO3 |
| Molecular Weight | 262.09 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | [(2S)-1-amino-1-oxopropan-2-yl] 2,4-dichlorobenzoate |
| SMILES | C[C@H](OC(=O)c1ccc(Cl)cc1Cl)C(N)=O |
| InChI | InChI=1S/C10H9Cl2NO3/c1-5(9(13)14)16-10(15)7-3-2-6(11)4-8(7)12/h2-5H,1H3,(H2,13,14)/t5-/m0/s1 |
| InChIKey | DVESQPKPJSUWPG-YFKPBYRVSA-N |
| XLogP | 2.02 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.09 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |