C13H14Cl2N2O4 — CID 7873069
[(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2,4-dichlorobenzoate (PubChem CID 7873069) has the molecular formula C13H14Cl2N2O4 and a molecular weight of 333.17 g/mol. Its IUPAC name is [(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2,4-dichlorobenzoate.
| Compound Name | [(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 7873069 |
| Molecular Formula | C13H14Cl2N2O4 |
| Molecular Weight | 333.17 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | [(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2,4-dichlorobenzoate |
| SMILES | CC(C)[C@@H](OC(=O)c1ccc(Cl)cc1Cl)C(=O)NC(N)=O |
| InChI | InChI=1S/C13H14Cl2N2O4/c1-6(2)10(11(18)17-13(16)20)21-12(19)8-4-3-7(14)5-9(8)15/h3-6,10H,1-2H3,(H3,16,17,18,20)/t10-/m1/s1 |
| InChIKey | UVNFMNGGUXXVMQ-SNVBAGLBSA-N |
| XLogP | 2.37 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.17 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |