C16H16ClN3O4 — CID 9009588
[(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-chloroquinoline-4-carboxylate (PubChem CID 9009588) has the molecular formula C16H16ClN3O4 and a molecular weight of 349.77 g/mol. Its IUPAC name is [(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-chloroquinoline-4-carboxylate.
| Compound Name | [(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-chloroquinoline-4-carboxylate |
|---|---|
| PubChem CID | 9009588 |
| Molecular Formula | C16H16ClN3O4 |
| Molecular Weight | 349.77 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | [(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-chloroquinoline-4-carboxylate |
| SMILES | CC(C)[C@@H](OC(=O)c1cc(Cl)nc2ccccc12)C(=O)NC(N)=O |
| InChI | InChI=1S/C16H16ClN3O4/c1-8(2)13(14(21)20-16(18)23)24-15(22)10-7-12(17)19-11-6-4-3-5-9(10)11/h3-8,13H,1-2H3,(H3,18,20,21,23)/t13-/m1/s1 |
| InChIKey | CBCROUBYBXOPTJ-CYBMUJFWSA-N |
| XLogP | 2.26 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.77 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|