C20H19N3O5 — CID 7825285
[(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-(furan-2-yl)quinoline-4-carboxylate (PubChem CID 7825285) has the molecular formula C20H19N3O5 and a molecular weight of 381.39 g/mol. Its IUPAC name is [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-(furan-2-yl)quinoline-4-carboxylate.
| Compound Name | [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-(furan-2-yl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 7825285 |
| Molecular Formula | C20H19N3O5 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-(furan-2-yl)quinoline-4-carboxylate |
| SMILES | CC(C)[C@H](OC(=O)c1cc(-c2ccco2)nc2ccccc12)C(=O)NC(N)=O |
| InChI | InChI=1S/C20H19N3O5/c1-11(2)17(18(24)23-20(21)26)28-19(25)13-10-15(16-8-5-9-27-16)22-14-7-4-3-6-12(13)14/h3-11,17H,1-2H3,(H3,21,23,24,26)/t17-/m0/s1 |
| InChIKey | BZQVXJCVFKOZOC-KRWDZBQOSA-N |
| XLogP | 2.87 |
| TPSA | 124.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |