C23H16ClNO4 — CID 16568855
[1-(3-chlorophenyl)-1-oxopropan-2-yl] 2-(furan-2-yl)quinoline-4-carboxylate (PubChem CID 16568855) has the molecular formula C23H16ClNO4 and a molecular weight of 405.84 g/mol. Its IUPAC name is [1-(3-chlorophenyl)-1-oxopropan-2-yl] 2-(furan-2-yl)quinoline-4-carboxylate.
| Compound Name | [1-(3-chlorophenyl)-1-oxopropan-2-yl] 2-(furan-2-yl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 16568855 |
| Molecular Formula | C23H16ClNO4 |
| Molecular Weight | 405.84 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | [1-(3-chlorophenyl)-1-oxopropan-2-yl] 2-(furan-2-yl)quinoline-4-carboxylate |
| SMILES | CC(OC(=O)c1cc(-c2ccco2)nc2ccccc12)C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H16ClNO4/c1-14(22(26)15-6-4-7-16(24)12-15)29-23(27)18-13-20(21-10-5-11-28-21)25-19-9-3-2-8-17(18)19/h2-14H,1H3 |
| InChIKey | POSUTSLTAUCKHY-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.84 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |