C22H23N3O5 — CID 16528721
[2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate (PubChem CID 16528721) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate.
| Compound Name | [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 16528721 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate |
| SMILES | CC(C)CCNC(=O)NC(=O)COC(=O)c1cc(-c2ccco2)nc2ccccc12 |
| InChI | InChI=1S/C22H23N3O5/c1-14(2)9-10-23-22(28)25-20(26)13-30-21(27)16-12-18(19-8-5-11-29-19)24-17-7-4-3-6-15(16)17/h3-8,11-12,14H,9-10,13H2,1-2H3,(H2,23,25,26,28) |
| InChIKey | IFAAFHWMFZFBDU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |