C27H27N3O4 — CID 23876555
[2-[4-[ethyl(propan-2-yl)amino]anilino]-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate (PubChem CID 23876555) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is [2-[4-[ethyl(propan-2-yl)amino]anilino]-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate.
| Compound Name | [2-[4-[ethyl(propan-2-yl)amino]anilino]-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 23876555 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | [2-[4-[ethyl(propan-2-yl)amino]anilino]-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate |
| SMILES | CCN(c1ccc(NC(=O)COC(=O)c2cc(-c3ccco3)nc3ccccc23)cc1)C(C)C |
| InChI | InChI=1S/C27H27N3O4/c1-4-30(18(2)3)20-13-11-19(12-14-20)28-26(31)17-34-27(32)22-16-24(25-10-7-15-33-25)29-23-9-6-5-8-21(22)23/h5-16,18H,4,17H2,1-3H3,(H,28,31) |
| InChIKey | GNYGQCFJKWXNFL-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |