C13H14BrClN2O4 — CID 18080378
[1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 5-bromo-2-chlorobenzoate (PubChem CID 18080378) has the molecular formula C13H14BrClN2O4 and a molecular weight of 377.62 g/mol. Its IUPAC name is [1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 5-bromo-2-chlorobenzoate.
| Compound Name | [1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 5-bromo-2-chlorobenzoate |
|---|---|
| PubChem CID | 18080378 |
| Molecular Formula | C13H14BrClN2O4 |
| Molecular Weight | 377.62 g/mol |
| Exact Mass | 375.98 |
| IUPAC Name | [1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 5-bromo-2-chlorobenzoate |
| SMILES | CC(C)C(OC(=O)c1cc(Br)ccc1Cl)C(=O)NC(N)=O |
| InChI | InChI=1S/C13H14BrClN2O4/c1-6(2)10(11(18)17-13(16)20)21-12(19)8-5-7(14)3-4-9(8)15/h3-6,10H,1-2H3,(H3,16,17,18,20) |
| InChIKey | KPCGGCCGPXKVNS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.62 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |