C14H17BrN2O4S — CID 7903248
[(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-(4-bromophenyl)sulfanylacetate (PubChem CID 7903248) has the molecular formula C14H17BrN2O4S and a molecular weight of 389.27 g/mol. Its IUPAC name is [(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-(4-bromophenyl)sulfanylacetate.
| Compound Name | [(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-(4-bromophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 7903248 |
| Molecular Formula | C14H17BrN2O4S |
| Molecular Weight | 389.27 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | [(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-(4-bromophenyl)sulfanylacetate |
| SMILES | CC(C)[C@@H](OC(=O)CSc1ccc(Br)cc1)C(=O)NC(N)=O |
| InChI | InChI=1S/C14H17BrN2O4S/c1-8(2)12(13(19)17-14(16)20)21-11(18)7-22-10-5-3-9(15)4-6-10/h3-6,8,12H,7H2,1-2H3,(H3,16,17,19,20)/t12-/m1/s1 |
| InChIKey | PRKCCMKXEBMWAP-GFCCVEGCSA-N |
| XLogP | 2.30 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |