C16H20BrNO3S — CID 55326912
[1-(cyclopentylamino)-1-oxopropan-2-yl] 2-(4-bromophenyl)sulfanylacetate (PubChem CID 55326912) has the molecular formula C16H20BrNO3S and a molecular weight of 386.31 g/mol. Its IUPAC name is [1-(cyclopentylamino)-1-oxopropan-2-yl] 2-(4-bromophenyl)sulfanylacetate.
| Compound Name | [1-(cyclopentylamino)-1-oxopropan-2-yl] 2-(4-bromophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 55326912 |
| Molecular Formula | C16H20BrNO3S |
| Molecular Weight | 386.31 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | [1-(cyclopentylamino)-1-oxopropan-2-yl] 2-(4-bromophenyl)sulfanylacetate |
| SMILES | CC(OC(=O)CSc1ccc(Br)cc1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C16H20BrNO3S/c1-11(16(20)18-13-4-2-3-5-13)21-15(19)10-22-14-8-6-12(17)7-9-14/h6-9,11,13H,2-5,10H2,1H3,(H,18,20) |
| InChIKey | GKYPJNJGSAFILZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |