C18H25NO3S — CID 7229605
[(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl] 2-(2-methylphenyl)sulfanylacetate (PubChem CID 7229605) has the molecular formula C18H25NO3S and a molecular weight of 335.47 g/mol. Its IUPAC name is [(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl] 2-(2-methylphenyl)sulfanylacetate.
| Compound Name | [(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl] 2-(2-methylphenyl)sulfanylacetate |
|---|---|
| PubChem CID | 7229605 |
| Molecular Formula | C18H25NO3S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | [(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl] 2-(2-methylphenyl)sulfanylacetate |
| SMILES | Cc1ccccc1SCC(=O)O[C@H](C)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C18H25NO3S/c1-13-8-6-7-11-16(13)23-12-17(20)22-14(2)18(21)19-15-9-4-3-5-10-15/h6-8,11,14-15H,3-5,9-10,12H2,1-2H3,(H,19,21)/t14-/m1/s1 |
| InChIKey | MXFAGKLWVWMKNI-CQSZACIVSA-N |
| XLogP | 3.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |