C12H15NO3S — CID 2571153
[(2R)-1-amino-1-oxopropan-2-yl] 2-(2-methylphenyl)sulfanylacetate (PubChem CID 2571153) has the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. Its IUPAC name is [(2R)-1-amino-1-oxopropan-2-yl] 2-(2-methylphenyl)sulfanylacetate.
| Compound Name | [(2R)-1-amino-1-oxopropan-2-yl] 2-(2-methylphenyl)sulfanylacetate |
|---|---|
| PubChem CID | 2571153 |
| Molecular Formula | C12H15NO3S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | [(2R)-1-amino-1-oxopropan-2-yl] 2-(2-methylphenyl)sulfanylacetate |
| SMILES | Cc1ccccc1SCC(=O)O[C@H](C)C(N)=O |
| InChI | InChI=1S/C12H15NO3S/c1-8-5-3-4-6-10(8)17-7-11(14)16-9(2)12(13)15/h3-6,9H,7H2,1-2H3,(H2,13,15)/t9-/m1/s1 |
| InChIKey | DGDUHEVODCGIHG-SECBINFHSA-N |
| XLogP | 1.50 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |