C12H15NO4S — CID 8550531
[(2S)-1-amino-1-oxopropan-2-yl] 2-(4-methoxyphenyl)sulfanylacetate (PubChem CID 8550531) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is [(2S)-1-amino-1-oxopropan-2-yl] 2-(4-methoxyphenyl)sulfanylacetate.
| Compound Name | [(2S)-1-amino-1-oxopropan-2-yl] 2-(4-methoxyphenyl)sulfanylacetate |
|---|---|
| PubChem CID | 8550531 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | [(2S)-1-amino-1-oxopropan-2-yl] 2-(4-methoxyphenyl)sulfanylacetate |
| SMILES | COc1ccc(SCC(=O)O[C@@H](C)C(N)=O)cc1 |
| InChI | InChI=1S/C12H15NO4S/c1-8(12(13)15)17-11(14)7-18-10-5-3-9(16-2)4-6-10/h3-6,8H,7H2,1-2H3,(H2,13,15)/t8-/m0/s1 |
| InChIKey | FETHWCIKITTZFA-QMMMGPOBSA-N |
| XLogP | 1.20 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |