C12H16O3S — CID 60704324
propan-2-yl 2-(4-methoxyphenyl)sulfanylacetate (PubChem CID 60704324) has the molecular formula C12H16O3S and a molecular weight of 240.32 g/mol. Its IUPAC name is propan-2-yl 2-(4-methoxyphenyl)sulfanylacetate.
| Compound Name | propan-2-yl 2-(4-methoxyphenyl)sulfanylacetate |
|---|---|
| PubChem CID | 60704324 |
| Molecular Formula | C12H16O3S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | propan-2-yl 2-(4-methoxyphenyl)sulfanylacetate |
| SMILES | COc1ccc(SCC(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C12H16O3S/c1-9(2)15-12(13)8-16-11-6-4-10(14-3)5-7-11/h4-7,9H,8H2,1-3H3 |
| InChIKey | RZLZKDGBMYZZGS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |