C15H20N2O6 — CID 7846762
[(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-(4-methoxyphenoxy)acetate (PubChem CID 7846762) has the molecular formula C15H20N2O6 and a molecular weight of 324.33 g/mol. Its IUPAC name is [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-(4-methoxyphenoxy)acetate.
| Compound Name | [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-(4-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 7846762 |
| Molecular Formula | C15H20N2O6 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-(4-methoxyphenoxy)acetate |
| SMILES | COc1ccc(OCC(=O)O[C@H](C(=O)NC(N)=O)C(C)C)cc1 |
| InChI | InChI=1S/C15H20N2O6/c1-9(2)13(14(19)17-15(16)20)23-12(18)8-22-11-6-4-10(21-3)5-7-11/h4-7,9,13H,8H2,1-3H3,(H3,16,17,19,20)/t13-/m0/s1 |
| InChIKey | HCLXSHHKVISUPG-ZDUSSCGKSA-N |
| XLogP | 0.84 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |