C21H22N2O6 — CID 7839628
[(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-(4-benzoylphenoxy)acetate (PubChem CID 7839628) has the molecular formula C21H22N2O6 and a molecular weight of 398.42 g/mol. Its IUPAC name is [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-(4-benzoylphenoxy)acetate.
| Compound Name | [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-(4-benzoylphenoxy)acetate |
|---|---|
| PubChem CID | 7839628 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-(4-benzoylphenoxy)acetate |
| SMILES | CC(C)[C@H](OC(=O)COc1ccc(C(=O)c2ccccc2)cc1)C(=O)NC(N)=O |
| InChI | InChI=1S/C21H22N2O6/c1-13(2)19(20(26)23-21(22)27)29-17(24)12-28-16-10-8-15(9-11-16)18(25)14-6-4-3-5-7-14/h3-11,13,19H,12H2,1-2H3,(H3,22,23,26,27)/t19-/m0/s1 |
| InChIKey | OOESIZWAYWQJEH-IBGZPJMESA-N |
| XLogP | 2.06 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |