C22H24N2O6 — CID 8925625
[2-[[(2S)-butan-2-yl]carbamoylamino]-2-oxoethyl] 2-(4-benzoylphenoxy)acetate (PubChem CID 8925625) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is [2-[[(2S)-butan-2-yl]carbamoylamino]-2-oxoethyl] 2-(4-benzoylphenoxy)acetate.
| Compound Name | [2-[[(2S)-butan-2-yl]carbamoylamino]-2-oxoethyl] 2-(4-benzoylphenoxy)acetate |
|---|---|
| PubChem CID | 8925625 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | [2-[[(2S)-butan-2-yl]carbamoylamino]-2-oxoethyl] 2-(4-benzoylphenoxy)acetate |
| SMILES | CC[C@H](C)NC(=O)NC(=O)COC(=O)COc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H24N2O6/c1-3-15(2)23-22(28)24-19(25)13-30-20(26)14-29-18-11-9-17(10-12-18)21(27)16-7-5-4-6-8-16/h4-12,15H,3,13-14H2,1-2H3,(H2,23,24,25,28)/t15-/m0/s1 |
| InChIKey | NENMYXMEMYTABC-HNNXBMFYSA-N |
| XLogP | 2.46 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |