C15H19N3O7 — CID 7789096
[2-[[(2R)-butan-2-yl]carbamoylamino]-2-oxoethyl] 2-(2-nitrophenoxy)acetate (PubChem CID 7789096) has the molecular formula C15H19N3O7 and a molecular weight of 353.33 g/mol. Its IUPAC name is [2-[[(2R)-butan-2-yl]carbamoylamino]-2-oxoethyl] 2-(2-nitrophenoxy)acetate.
| Compound Name | [2-[[(2R)-butan-2-yl]carbamoylamino]-2-oxoethyl] 2-(2-nitrophenoxy)acetate |
|---|---|
| PubChem CID | 7789096 |
| Molecular Formula | C15H19N3O7 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | [2-[[(2R)-butan-2-yl]carbamoylamino]-2-oxoethyl] 2-(2-nitrophenoxy)acetate |
| SMILES | CC[C@@H](C)NC(=O)NC(=O)COC(=O)COc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H19N3O7/c1-3-10(2)16-15(21)17-13(19)8-25-14(20)9-24-12-7-5-4-6-11(12)18(22)23/h4-7,10H,3,8-9H2,1-2H3,(H2,16,17,19,21)/t10-/m1/s1 |
| InChIKey | KFNJTRMBOGFYBD-SNVBAGLBSA-N |
| XLogP | 1.14 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|