C13H13N3O5 — CID 2078238
[(2R)-1-(carbamoylamino)-1-oxopropan-2-yl] 2-(4-cyanophenoxy)acetate (PubChem CID 2078238) has the molecular formula C13H13N3O5 and a molecular weight of 291.26 g/mol. Its IUPAC name is [(2R)-1-(carbamoylamino)-1-oxopropan-2-yl] 2-(4-cyanophenoxy)acetate.
| Compound Name | [(2R)-1-(carbamoylamino)-1-oxopropan-2-yl] 2-(4-cyanophenoxy)acetate |
|---|---|
| PubChem CID | 2078238 |
| Molecular Formula | C13H13N3O5 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | [(2R)-1-(carbamoylamino)-1-oxopropan-2-yl] 2-(4-cyanophenoxy)acetate |
| SMILES | C[C@@H](OC(=O)COc1ccc(C#N)cc1)C(=O)NC(N)=O |
| InChI | InChI=1S/C13H13N3O5/c1-8(12(18)16-13(15)19)21-11(17)7-20-10-4-2-9(6-14)3-5-10/h2-5,8H,7H2,1H3,(H3,15,16,18,19)/t8-/m1/s1 |
| InChIKey | IROSBKLKYRUOBV-MRVPVSSYSA-N |
| XLogP | 0.06 |
| TPSA | 131.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |