C19H28N2O5 — CID 7855981
[(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 3-(4-tert-butylphenoxy)propanoate (PubChem CID 7855981) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 3-(4-tert-butylphenoxy)propanoate.
| Compound Name | [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 3-(4-tert-butylphenoxy)propanoate |
|---|---|
| PubChem CID | 7855981 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 3-(4-tert-butylphenoxy)propanoate |
| SMILES | CC(C)[C@H](OC(=O)CCOc1ccc(C(C)(C)C)cc1)C(=O)NC(N)=O |
| InChI | InChI=1S/C19H28N2O5/c1-12(2)16(17(23)21-18(20)24)26-15(22)10-11-25-14-8-6-13(7-9-14)19(3,4)5/h6-9,12,16H,10-11H2,1-5H3,(H3,20,21,23,24)/t16-/m0/s1 |
| InChIKey | WUAWZIKGNKPNQP-INIZCTEOSA-N |
| XLogP | 2.52 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |