C16H22N2O5 — CID 7840296
[(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 3-(3-methylphenoxy)propanoate (PubChem CID 7840296) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is [(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 3-(3-methylphenoxy)propanoate.
| Compound Name | [(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 3-(3-methylphenoxy)propanoate |
|---|---|
| PubChem CID | 7840296 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | [(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 3-(3-methylphenoxy)propanoate |
| SMILES | Cc1cccc(OCCC(=O)O[C@@H](C(=O)NC(N)=O)C(C)C)c1 |
| InChI | InChI=1S/C16H22N2O5/c1-10(2)14(15(20)18-16(17)21)23-13(19)7-8-22-12-6-4-5-11(3)9-12/h4-6,9-10,14H,7-8H2,1-3H3,(H3,17,18,20,21)/t14-/m1/s1 |
| InChIKey | JUQCDLQTUSZXBC-CQSZACIVSA-N |
| XLogP | 1.53 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |