C15H20N2O5 — CID 9139385
[(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 3-(3-methylphenoxy)propanoate (PubChem CID 9139385) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is [(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 3-(3-methylphenoxy)propanoate.
| Compound Name | [(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 3-(3-methylphenoxy)propanoate |
|---|---|
| PubChem CID | 9139385 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | [(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 3-(3-methylphenoxy)propanoate |
| SMILES | CNC(=O)NC(=O)[C@@H](C)OC(=O)CCOc1cccc(C)c1 |
| InChI | InChI=1S/C15H20N2O5/c1-10-5-4-6-12(9-10)21-8-7-13(18)22-11(2)14(19)17-15(20)16-3/h4-6,9,11H,7-8H2,1-3H3,(H2,16,17,19,20)/t11-/m1/s1 |
| InChIKey | NKJQFNWFAXIJFL-LLVKDONJSA-N |
| XLogP | 1.15 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |