C14H18N2O5 — CID 7841458
[(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 3-phenoxypropanoate (PubChem CID 7841458) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is [(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 3-phenoxypropanoate.
| Compound Name | [(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 3-phenoxypropanoate |
|---|---|
| PubChem CID | 7841458 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | [(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 3-phenoxypropanoate |
| SMILES | CNC(=O)NC(=O)[C@@H](C)OC(=O)CCOc1ccccc1 |
| InChI | InChI=1S/C14H18N2O5/c1-10(13(18)16-14(19)15-2)21-12(17)8-9-20-11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3,(H2,15,16,18,19)/t10-/m1/s1 |
| InChIKey | CBROEZUCHCLAHY-SNVBAGLBSA-N |
| XLogP | 0.84 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |