C18H26N2O5 — CID 46629603
[1-(tert-butylcarbamoylamino)-1-oxopropan-2-yl] 4-phenoxybutanoate (PubChem CID 46629603) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is [1-(tert-butylcarbamoylamino)-1-oxopropan-2-yl] 4-phenoxybutanoate.
| Compound Name | [1-(tert-butylcarbamoylamino)-1-oxopropan-2-yl] 4-phenoxybutanoate |
|---|---|
| PubChem CID | 46629603 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | [1-(tert-butylcarbamoylamino)-1-oxopropan-2-yl] 4-phenoxybutanoate |
| SMILES | CC(OC(=O)CCCOc1ccccc1)C(=O)NC(=O)NC(C)(C)C |
| InChI | InChI=1S/C18H26N2O5/c1-13(16(22)19-17(23)20-18(2,3)4)25-15(21)11-8-12-24-14-9-6-5-7-10-14/h5-7,9-10,13H,8,11-12H2,1-4H3,(H2,19,20,22,23) |
| InChIKey | AIFCJILANSIRAN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|