C19H28N2O5 — CID 8938677
[(2R)-1-(tert-butylcarbamoylamino)-1-oxopropan-2-yl] 2-(2-propan-2-ylphenoxy)acetate (PubChem CID 8938677) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is [(2R)-1-(tert-butylcarbamoylamino)-1-oxopropan-2-yl] 2-(2-propan-2-ylphenoxy)acetate.
| Compound Name | [(2R)-1-(tert-butylcarbamoylamino)-1-oxopropan-2-yl] 2-(2-propan-2-ylphenoxy)acetate |
|---|---|
| PubChem CID | 8938677 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | [(2R)-1-(tert-butylcarbamoylamino)-1-oxopropan-2-yl] 2-(2-propan-2-ylphenoxy)acetate |
| SMILES | CC(C)c1ccccc1OCC(=O)O[C@H](C)C(=O)NC(=O)NC(C)(C)C |
| InChI | InChI=1S/C19H28N2O5/c1-12(2)14-9-7-8-10-15(14)25-11-16(22)26-13(3)17(23)20-18(24)21-19(4,5)6/h7-10,12-13H,11H2,1-6H3,(H2,20,21,23,24)/t13-/m1/s1 |
| InChIKey | YWGGDJZSDYELIX-CYBMUJFWSA-N |
| XLogP | 2.74 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |