C14H17BrN2O5 — CID 4264667
[1-(carbamoylamino)-1-oxopropan-2-yl] 4-(3-bromophenoxy)butanoate (PubChem CID 4264667) has the molecular formula C14H17BrN2O5 and a molecular weight of 373.20 g/mol. Its IUPAC name is [1-(carbamoylamino)-1-oxopropan-2-yl] 4-(3-bromophenoxy)butanoate.
| Compound Name | [1-(carbamoylamino)-1-oxopropan-2-yl] 4-(3-bromophenoxy)butanoate |
|---|---|
| PubChem CID | 4264667 |
| Molecular Formula | C14H17BrN2O5 |
| Molecular Weight | 373.20 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | [1-(carbamoylamino)-1-oxopropan-2-yl] 4-(3-bromophenoxy)butanoate |
| SMILES | CC(OC(=O)CCCOc1cccc(Br)c1)C(=O)NC(N)=O |
| InChI | InChI=1S/C14H17BrN2O5/c1-9(13(19)17-14(16)20)22-12(18)6-3-7-21-11-5-2-4-10(15)8-11/h2,4-5,8-9H,3,6-7H2,1H3,(H3,16,17,19,20) |
| InChIKey | JRVAWHSSTGDLID-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.20 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|