C12H13BrN2O5 — CID 7880305
[2-(carbamoylamino)-2-oxoethyl] 3-(3-bromophenoxy)propanoate (PubChem CID 7880305) has the molecular formula C12H13BrN2O5 and a molecular weight of 345.15 g/mol. Its IUPAC name is [2-(carbamoylamino)-2-oxoethyl] 3-(3-bromophenoxy)propanoate.
| Compound Name | [2-(carbamoylamino)-2-oxoethyl] 3-(3-bromophenoxy)propanoate |
|---|---|
| PubChem CID | 7880305 |
| Molecular Formula | C12H13BrN2O5 |
| Molecular Weight | 345.15 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | [2-(carbamoylamino)-2-oxoethyl] 3-(3-bromophenoxy)propanoate |
| SMILES | NC(=O)NC(=O)COC(=O)CCOc1cccc(Br)c1 |
| InChI | InChI=1S/C12H13BrN2O5/c13-8-2-1-3-9(6-8)19-5-4-11(17)20-7-10(16)15-12(14)18/h1-3,6H,4-5,7H2,(H3,14,15,16,18) |
| InChIKey | CNZUBPVAKWYKQL-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.15 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |