C12H14N2O5 — CID 7853444
[2-(carbamoylamino)-2-oxoethyl] 2-(3-methylphenoxy)acetate (PubChem CID 7853444) has the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. Its IUPAC name is [2-(carbamoylamino)-2-oxoethyl] 2-(3-methylphenoxy)acetate.
| Compound Name | [2-(carbamoylamino)-2-oxoethyl] 2-(3-methylphenoxy)acetate |
|---|---|
| PubChem CID | 7853444 |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | [2-(carbamoylamino)-2-oxoethyl] 2-(3-methylphenoxy)acetate |
| SMILES | Cc1cccc(OCC(=O)OCC(=O)NC(N)=O)c1 |
| InChI | InChI=1S/C12H14N2O5/c1-8-3-2-4-9(5-8)18-7-11(16)19-6-10(15)14-12(13)17/h2-5H,6-7H2,1H3,(H3,13,14,15,17) |
| InChIKey | XIJUGQDPBZQOPX-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |