(3,3-dimethyl-2-oxobutyl) 2-(3-methylphenoxy)acetate

C15H20O4 — CID 2358385

IUPAC(3,3-dimethyl-2-oxobutyl) 2-(3-methylphenoxy)acetate
SMILESCc1cccc(OCC(=O)OCC(=O)C(C)(C)C)c1
InChIInChI=1S/C15H20O4/c1-11-6-5-7-12(8-11)18-10-14(17)19-9-13(16)15(2,3)4/h5-8H,9-10H2,1-4H3
InChIKeyXZQUASUHAXJORA-UHFFFAOYSA-N
MW264.32 g/mol
LogP2.53
Rot. Bonds5

About (3,3-dimethyl-2-oxobutyl) 2-(3-methylphenoxy)acetate

(3,3-dimethyl-2-oxobutyl) 2-(3-methylphenoxy)acetate (PubChem CID 2358385) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl) 2-(3-methylphenoxy)acetate.

Molecular Properties

Compound Name(3,3-dimethyl-2-oxobutyl) 2-(3-methylphenoxy)acetate
PubChem CID2358385
Molecular FormulaC15H20O4
Molecular Weight264.32 g/mol
Exact Mass264.14
IUPAC Name(3,3-dimethyl-2-oxobutyl) 2-(3-methylphenoxy)acetate
SMILESCc1cccc(OCC(=O)OCC(=O)C(C)(C)C)c1
InChIInChI=1S/C15H20O4/c1-11-6-5-7-12(8-11)18-10-14(17)19-9-13(16)15(2,3)4/h5-8H,9-10H2,1-4H3
InChIKeyXZQUASUHAXJORA-UHFFFAOYSA-N
XLogP2.53
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.32
LogP ≤ 52.53
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze (3,3-dimethyl-2-oxobutyl) 2-(3-methylphenoxy)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3,3-dimethyl-2-oxobutyl) 2-(3-methylphenoxy)acetate?
The IUPAC name of (3,3-dimethyl-2-oxobutyl) 2-(3-methylphenoxy)acetate (CID 2358385) is (3,3-dimethyl-2-oxobutyl) 2-(3-methylphenoxy)acetate.
What is the SMILES notation for (3,3-dimethyl-2-oxobutyl) 2-(3-methylphenoxy)acetate?
The canonical SMILES for (3,3-dimethyl-2-oxobutyl) 2-(3-methylphenoxy)acetate is Cc1cccc(OCC(=O)OCC(=O)C(C)(C)C)c1.
What is the InChIKey of (3,3-dimethyl-2-oxobutyl) 2-(3-methylphenoxy)acetate?
The InChIKey is XZQUASUHAXJORA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O4/c1-11-6-5-7-12(8-11)18-10-14(17)19-9-13(16)15(2,3)4/h5-8H,9-10H2,1-4H3.
What are the key properties of (3,3-dimethyl-2-oxobutyl) 2-(3-methylphenoxy)acetate?
(3,3-dimethyl-2-oxobutyl) 2-(3-methylphenoxy)acetate has a molecular weight of 264.32 g/mol, XLogP of 2.53, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-dimethyl-2-oxobutyl) 2-(3-methylphenoxy)acetate is sourced from PubChem (CID 2358385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).