C15H16BrF3N2O5 — CID 27337868
[2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] 4-(3-bromophenoxy)butanoate (PubChem CID 27337868) has the molecular formula C15H16BrF3N2O5 and a molecular weight of 441.20 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] 4-(3-bromophenoxy)butanoate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] 4-(3-bromophenoxy)butanoate |
|---|---|
| PubChem CID | 27337868 |
| Molecular Formula | C15H16BrF3N2O5 |
| Molecular Weight | 441.20 g/mol |
| Exact Mass | 440.02 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] 4-(3-bromophenoxy)butanoate |
| SMILES | O=C(COC(=O)CCCOc1cccc(Br)c1)NC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C15H16BrF3N2O5/c16-10-3-1-4-11(7-10)25-6-2-5-13(23)26-8-12(22)21-14(24)20-9-15(17,18)19/h1,3-4,7H,2,5-6,8-9H2,(H2,20,21,22,24) |
| InChIKey | XMWXOLJQOLUBKA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.20 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|