C18H26N2O5 — CID 55418114
[2-(butylcarbamoylamino)-2-oxoethyl] 4-(3-methylphenoxy)butanoate (PubChem CID 55418114) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is [2-(butylcarbamoylamino)-2-oxoethyl] 4-(3-methylphenoxy)butanoate.
| Compound Name | [2-(butylcarbamoylamino)-2-oxoethyl] 4-(3-methylphenoxy)butanoate |
|---|---|
| PubChem CID | 55418114 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | [2-(butylcarbamoylamino)-2-oxoethyl] 4-(3-methylphenoxy)butanoate |
| SMILES | CCCCNC(=O)NC(=O)COC(=O)CCCOc1cccc(C)c1 |
| InChI | InChI=1S/C18H26N2O5/c1-3-4-10-19-18(23)20-16(21)13-25-17(22)9-6-11-24-15-8-5-7-14(2)12-15/h5,7-8,12H,3-4,6,9-11,13H2,1-2H3,(H2,19,20,21,23) |
| InChIKey | ORZPQZAEBGPFHE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|