About 2-(3-methylphenoxy)ethyl butanoate
2-(3-methylphenoxy)ethyl butanoate (PubChem CID 13247559) has the molecular formula C13H18O3
and a molecular weight of 222.28 g/mol. Its IUPAC name is 2-(3-methylphenoxy)ethyl butanoate.
Molecular Properties
| Compound Name | 2-(3-methylphenoxy)ethyl butanoate |
| PubChem CID | 13247559 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 2-(3-methylphenoxy)ethyl butanoate |
| SMILES | CCCC(=O)OCCOc1cccc(C)c1 |
| InChI | InChI=1S/C13H18O3/c1-3-5-13(14)16-9-8-15-12-7-4-6-11(2)10-12/h4,6-7,10H,3,5,8-9H2,1-2H3 |
| InChIKey | ZFBGVJYXYVDOFK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methylphenoxy)ethyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methylphenoxy)ethyl butanoate?
The IUPAC name of 2-(3-methylphenoxy)ethyl butanoate (CID 13247559) is 2-(3-methylphenoxy)ethyl butanoate.
What is the SMILES notation for 2-(3-methylphenoxy)ethyl butanoate?
The canonical SMILES for 2-(3-methylphenoxy)ethyl butanoate is CCCC(=O)OCCOc1cccc(C)c1.
What is the InChIKey of 2-(3-methylphenoxy)ethyl butanoate?
The InChIKey is ZFBGVJYXYVDOFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O3/c1-3-5-13(14)16-9-8-15-12-7-4-6-11(2)10-12/h4,6-7,10H,3,5,8-9H2,1-2H3.
What are the key properties of 2-(3-methylphenoxy)ethyl butanoate?
2-(3-methylphenoxy)ethyl butanoate has a molecular weight of 222.28 g/mol, XLogP of 2.72, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methylphenoxy)ethyl butanoate is sourced from PubChem (CID 13247559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).