C15H20N2O4S — CID 7806532
[(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] (2R)-2-phenylsulfanylpropanoate (PubChem CID 7806532) has the molecular formula C15H20N2O4S and a molecular weight of 324.40 g/mol. Its IUPAC name is [(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] (2R)-2-phenylsulfanylpropanoate.
| Compound Name | [(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] (2R)-2-phenylsulfanylpropanoate |
|---|---|
| PubChem CID | 7806532 |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | [(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] (2R)-2-phenylsulfanylpropanoate |
| SMILES | CC(C)[C@@H](OC(=O)[C@@H](C)Sc1ccccc1)C(=O)NC(N)=O |
| InChI | InChI=1S/C15H20N2O4S/c1-9(2)12(13(18)17-15(16)20)21-14(19)10(3)22-11-7-5-4-6-8-11/h4-10,12H,1-3H3,(H3,16,17,18,20)/t10-,12-/m1/s1 |
| InChIKey | OBYSNPDEHXGHCY-ZYHUDNBSSA-N |
| XLogP | 1.93 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |