C12H16N2O4S — CID 7968677
[(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-thiophen-3-ylacetate (PubChem CID 7968677) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-thiophen-3-ylacetate.
| Compound Name | [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-thiophen-3-ylacetate |
|---|---|
| PubChem CID | 7968677 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-thiophen-3-ylacetate |
| SMILES | CC(C)[C@H](OC(=O)Cc1ccsc1)C(=O)NC(N)=O |
| InChI | InChI=1S/C12H16N2O4S/c1-7(2)10(11(16)14-12(13)17)18-9(15)5-8-3-4-19-6-8/h3-4,6-7,10H,5H2,1-2H3,(H3,13,14,16,17)/t10-/m0/s1 |
| InChIKey | YSPNNBMZQPHOQW-JTQLQIEISA-N |
| XLogP | 1.05 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |