About [(2S)-2-methylbutyl] 2-thiophen-3-ylacetate
[(2S)-2-methylbutyl] 2-thiophen-3-ylacetate (PubChem CID 101245181) has the molecular formula C11H16O2S
and a molecular weight of 212.31 g/mol. Its IUPAC name is [(2S)-2-methylbutyl] 2-thiophen-3-ylacetate.
Molecular Properties
| Compound Name | [(2S)-2-methylbutyl] 2-thiophen-3-ylacetate |
| PubChem CID | 101245181 |
| Molecular Formula | C11H16O2S |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | [(2S)-2-methylbutyl] 2-thiophen-3-ylacetate |
| SMILES | CC[C@H](C)COC(=O)Cc1ccsc1 |
| InChI | InChI=1S/C11H16O2S/c1-3-9(2)7-13-11(12)6-10-4-5-14-8-10/h4-5,8-9H,3,6-7H2,1-2H3/t9-/m0/s1 |
| InChIKey | WVTJWSZHMKHQDD-VIFPVBQESA-N |
| XLogP | 2.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S)-2-methylbutyl] 2-thiophen-3-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-methylbutyl] 2-thiophen-3-ylacetate?
The IUPAC name of [(2S)-2-methylbutyl] 2-thiophen-3-ylacetate (CID 101245181) is [(2S)-2-methylbutyl] 2-thiophen-3-ylacetate.
What is the SMILES notation for [(2S)-2-methylbutyl] 2-thiophen-3-ylacetate?
The canonical SMILES for [(2S)-2-methylbutyl] 2-thiophen-3-ylacetate is CC[C@H](C)COC(=O)Cc1ccsc1.
What is the InChIKey of [(2S)-2-methylbutyl] 2-thiophen-3-ylacetate?
The InChIKey is WVTJWSZHMKHQDD-VIFPVBQESA-N. The full InChI is InChI=1S/C11H16O2S/c1-3-9(2)7-13-11(12)6-10-4-5-14-8-10/h4-5,8-9H,3,6-7H2,1-2H3/t9-/m0/s1.
What are the key properties of [(2S)-2-methylbutyl] 2-thiophen-3-ylacetate?
[(2S)-2-methylbutyl] 2-thiophen-3-ylacetate has a molecular weight of 212.31 g/mol, XLogP of 2.88, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-methylbutyl] 2-thiophen-3-ylacetate is sourced from PubChem (CID 101245181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).