C11H13NO5S — CID 4668327
[2-(ethoxycarbonylamino)-2-oxoethyl] 2-thiophen-3-ylacetate (PubChem CID 4668327) has the molecular formula C11H13NO5S and a molecular weight of 271.29 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-2-oxoethyl] 2-thiophen-3-ylacetate.
| Compound Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 2-thiophen-3-ylacetate |
|---|---|
| PubChem CID | 4668327 |
| Molecular Formula | C11H13NO5S |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 2-thiophen-3-ylacetate |
| SMILES | CCOC(=O)NC(=O)COC(=O)Cc1ccsc1 |
| InChI | InChI=1S/C11H13NO5S/c1-2-16-11(15)12-9(13)6-17-10(14)5-8-3-4-18-7-8/h3-4,7H,2,5-6H2,1H3,(H,12,13,15) |
| InChIKey | BKFNQUQTMGRNDM-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |