C14H18N2O4S — CID 9417359
[2-[[2-(cyclopropylamino)-2-oxoethyl]-methylamino]-2-oxoethyl] 2-thiophen-3-ylacetate (PubChem CID 9417359) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is [2-[[2-(cyclopropylamino)-2-oxoethyl]-methylamino]-2-oxoethyl] 2-thiophen-3-ylacetate.
| Compound Name | [2-[[2-(cyclopropylamino)-2-oxoethyl]-methylamino]-2-oxoethyl] 2-thiophen-3-ylacetate |
|---|---|
| PubChem CID | 9417359 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | [2-[[2-(cyclopropylamino)-2-oxoethyl]-methylamino]-2-oxoethyl] 2-thiophen-3-ylacetate |
| SMILES | CN(CC(=O)NC1CC1)C(=O)COC(=O)Cc1ccsc1 |
| InChI | InChI=1S/C14H18N2O4S/c1-16(7-12(17)15-11-2-3-11)13(18)8-20-14(19)6-10-4-5-21-9-10/h4-5,9,11H,2-3,6-8H2,1H3,(H,15,17) |
| InChIKey | SVGXQIRSBMPTMJ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |