C15H13BrN2O4S — CID 7968657
[2-[2-(2-bromobenzoyl)hydrazinyl]-2-oxoethyl] 2-thiophen-3-ylacetate (PubChem CID 7968657) has the molecular formula C15H13BrN2O4S and a molecular weight of 397.25 g/mol. Its IUPAC name is [2-[2-(2-bromobenzoyl)hydrazinyl]-2-oxoethyl] 2-thiophen-3-ylacetate.
| Compound Name | [2-[2-(2-bromobenzoyl)hydrazinyl]-2-oxoethyl] 2-thiophen-3-ylacetate |
|---|---|
| PubChem CID | 7968657 |
| Molecular Formula | C15H13BrN2O4S |
| Molecular Weight | 397.25 g/mol |
| Exact Mass | 395.98 |
| IUPAC Name | [2-[2-(2-bromobenzoyl)hydrazinyl]-2-oxoethyl] 2-thiophen-3-ylacetate |
| SMILES | O=C(COC(=O)Cc1ccsc1)NNC(=O)c1ccccc1Br |
| InChI | InChI=1S/C15H13BrN2O4S/c16-12-4-2-1-3-11(12)15(21)18-17-13(19)8-22-14(20)7-10-5-6-23-9-10/h1-6,9H,7-8H2,(H,17,19)(H,18,21) |
| InChIKey | UWQULIKGAWMODC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.25 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|