C18H17BrN2O4 — CID 7775563
[2-[2-(2-bromobenzoyl)hydrazinyl]-2-oxoethyl] 4-ethylbenzoate (PubChem CID 7775563) has the molecular formula C18H17BrN2O4 and a molecular weight of 405.25 g/mol. Its IUPAC name is [2-[2-(2-bromobenzoyl)hydrazinyl]-2-oxoethyl] 4-ethylbenzoate.
| Compound Name | [2-[2-(2-bromobenzoyl)hydrazinyl]-2-oxoethyl] 4-ethylbenzoate |
|---|---|
| PubChem CID | 7775563 |
| Molecular Formula | C18H17BrN2O4 |
| Molecular Weight | 405.25 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | [2-[2-(2-bromobenzoyl)hydrazinyl]-2-oxoethyl] 4-ethylbenzoate |
| SMILES | CCc1ccc(C(=O)OCC(=O)NNC(=O)c2ccccc2Br)cc1 |
| InChI | InChI=1S/C18H17BrN2O4/c1-2-12-7-9-13(10-8-12)18(24)25-11-16(22)20-21-17(23)14-5-3-4-6-15(14)19/h3-10H,2,11H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | ZAGWRUMDWYLTOU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|