C17H16BrN3O4 — CID 7670728
[2-[2-(2-bromobenzoyl)hydrazinyl]-2-oxoethyl] 2-(methylamino)benzoate (PubChem CID 7670728) has the molecular formula C17H16BrN3O4 and a molecular weight of 406.24 g/mol. Its IUPAC name is [2-[2-(2-bromobenzoyl)hydrazinyl]-2-oxoethyl] 2-(methylamino)benzoate.
| Compound Name | [2-[2-(2-bromobenzoyl)hydrazinyl]-2-oxoethyl] 2-(methylamino)benzoate |
|---|---|
| PubChem CID | 7670728 |
| Molecular Formula | C17H16BrN3O4 |
| Molecular Weight | 406.24 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | [2-[2-(2-bromobenzoyl)hydrazinyl]-2-oxoethyl] 2-(methylamino)benzoate |
| SMILES | CNc1ccccc1C(=O)OCC(=O)NNC(=O)c1ccccc1Br |
| InChI | InChI=1S/C17H16BrN3O4/c1-19-14-9-5-3-7-12(14)17(24)25-10-15(22)20-21-16(23)11-6-2-4-8-13(11)18/h2-9,19H,10H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | XADVNLAUUCHADX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|