About [2-(2-benzoylanilino)-2-oxoethyl] 2-bromobenzoate
[2-(2-benzoylanilino)-2-oxoethyl] 2-bromobenzoate (PubChem CID 4664729) has the molecular formula C22H16BrNO4
and a molecular weight of 438.28 g/mol. Its IUPAC name is [2-(2-benzoylanilino)-2-oxoethyl] 2-bromobenzoate.
Molecular Properties
| Compound Name | [2-(2-benzoylanilino)-2-oxoethyl] 2-bromobenzoate |
| PubChem CID | 4664729 |
| Molecular Formula | C22H16BrNO4 |
| Molecular Weight | 438.28 g/mol |
| Exact Mass | 437.03 |
| IUPAC Name | [2-(2-benzoylanilino)-2-oxoethyl] 2-bromobenzoate |
| SMILES | O=C(COC(=O)c1ccccc1Br)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C22H16BrNO4/c23-18-12-6-4-10-16(18)22(27)28-14-20(25)24-19-13-7-5-11-17(19)21(26)15-8-2-1-3-9-15/h1-13H,14H2,(H,24,25) |
| InChIKey | AYEJXHGHCZXYJH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.28 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(2-benzoylanilino)-2-oxoethyl] 2-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-benzoylanilino)-2-oxoethyl] 2-bromobenzoate?
The IUPAC name of [2-(2-benzoylanilino)-2-oxoethyl] 2-bromobenzoate (CID 4664729) is [2-(2-benzoylanilino)-2-oxoethyl] 2-bromobenzoate.
What is the SMILES notation for [2-(2-benzoylanilino)-2-oxoethyl] 2-bromobenzoate?
The canonical SMILES for [2-(2-benzoylanilino)-2-oxoethyl] 2-bromobenzoate is O=C(COC(=O)c1ccccc1Br)Nc1ccccc1C(=O)c1ccccc1.
What is the InChIKey of [2-(2-benzoylanilino)-2-oxoethyl] 2-bromobenzoate?
The InChIKey is AYEJXHGHCZXYJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16BrNO4/c23-18-12-6-4-10-16(18)22(27)28-14-20(25)24-19-13-7-5-11-17(19)21(26)15-8-2-1-3-9-15/h1-13H,14H2,(H,24,25).
What are the key properties of [2-(2-benzoylanilino)-2-oxoethyl] 2-bromobenzoate?
[2-(2-benzoylanilino)-2-oxoethyl] 2-bromobenzoate has a molecular weight of 438.28 g/mol, XLogP of 4.48, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-benzoylanilino)-2-oxoethyl] 2-bromobenzoate is sourced from PubChem (CID 4664729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).