C22H17FN2O4 — CID 4576263
[2-(2-fluoroanilino)-2-oxoethyl] 2-benzamidobenzoate (PubChem CID 4576263) has the molecular formula C22H17FN2O4 and a molecular weight of 392.39 g/mol. Its IUPAC name is [2-(2-fluoroanilino)-2-oxoethyl] 2-benzamidobenzoate.
| Compound Name | [2-(2-fluoroanilino)-2-oxoethyl] 2-benzamidobenzoate |
|---|---|
| PubChem CID | 4576263 |
| Molecular Formula | C22H17FN2O4 |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | [2-(2-fluoroanilino)-2-oxoethyl] 2-benzamidobenzoate |
| SMILES | O=C(COC(=O)c1ccccc1NC(=O)c1ccccc1)Nc1ccccc1F |
| InChI | InChI=1S/C22H17FN2O4/c23-17-11-5-7-13-19(17)24-20(26)14-29-22(28)16-10-4-6-12-18(16)25-21(27)15-8-2-1-3-9-15/h1-13H,14H2,(H,24,26)(H,25,27) |
| InChIKey | PNIKYLNDBVZXNZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |