C20H17N3O4S — CID 3558595
[2-[(5-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl] 2-benzamidobenzoate (PubChem CID 3558595) has the molecular formula C20H17N3O4S and a molecular weight of 395.44 g/mol. Its IUPAC name is [2-[(5-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl] 2-benzamidobenzoate.
| Compound Name | [2-[(5-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl] 2-benzamidobenzoate |
|---|---|
| PubChem CID | 3558595 |
| Molecular Formula | C20H17N3O4S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | [2-[(5-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl] 2-benzamidobenzoate |
| SMILES | Cc1cnc(NC(=O)COC(=O)c2ccccc2NC(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C20H17N3O4S/c1-13-11-21-20(28-13)23-17(24)12-27-19(26)15-9-5-6-10-16(15)22-18(25)14-7-3-2-4-8-14/h2-11H,12H2,1H3,(H,22,25)(H,21,23,24) |
| InChIKey | OVYYJFWXYCCUKE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |